On Target PAR1_HUMAN 0.3108108/CHEMBL334510
For the given ligand Alclofenac, we have found in our database that, being scored 0.3108108, the most similar ligand is CHEMBL334510. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL334510 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | COc1c(I)cc(C[C@H](NC(=O)[C@H](Cc2ccc(Cl)c(Cl)c2)NC(=O)[C@H](C)N)C(=O)N[C@@H](CC3CCCCC3)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N)cc1I |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 00019000 47003208 20300108 04010e00 00001002 00000000 06050000 2000000c 00200880 000808c2 08300010 4003b800 0600807e 02002009 81080001 00040018 00000800 02000000 02002108 00020201 00010140 38240730 00000003 835c0018 00002800 80100000 40170000 10000000 0c000200 0006000b 20224000 00022600 |