On Target HYES_HUMAN 0.4148148/CHEMBL3818107
For the given ligand Aceclofenac, we have found in our database that, being scored 0.4148148, the most similar ligand is CHEMBL3818107. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL3818107 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CCOC(=O)C(C)Oc1ccc(CCNC(=O)Nc2ccc(Cl)cc2)cc1 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 04008006 00001008 20100108 00010e00 00001000 00000000 02040004 00002045 00002000 00080840 082c0004 4000d800 02809006 00100000 01200041 00080008 00060008 82400000 08000002 00020000 40000120 18210f00 25022000 89400018 00112400 80000000 001a0008 008000a0 04008200 00060003 00000000 02024600 |