On Target TRPV3_HUMAN 0.25641027/CHEMBL3664218
For the given ligand Curcumin, we have found in our database that, being scored 0.25641027, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc4ccc(Cl)cc24)c1OC5CCCC5 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |