On Target AOFA_HUMAN 0.28421053/CHEMBL1258719
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.28421053, the most similar ligand is CHEMBL1258719. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL1258719 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | O=C(c1ccccc1)c2nc3ccccc3n4cnnc24 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 0800000a 43800808 60001580 18010610 00045060 0008c004 0000a000 01601800 10400100 00080840 28088004 4080a000 00008800 00500000 008e0040 020c008c 08018000 02800005 00600400 40240801 c0000020 08028620 21806804 0042001c 00040400 80000000 08008000 40000804 00000084 00020803 c0040000 20200400 |