On Target ADRB2_HUMAN 0.33742332/CHEMBL4106289
For the given ligand Curcumin, we have found in our database that, being scored 0.33742332, the most similar ligand is CHEMBL4106289. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL4106289 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1cccc(\C=C\2/Oc3c(C[NH+]4CCCC4)c(O)cc(C)c3C2=O)c1 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 04001001 40000808 20100309 00010602 00001041 02828110 d2000081 22005640 81870108 00b81cc0 88a48000 4050c000 80808822 00200080 03040403 08082018 08000400 a2148000 04098400 00020a01 00000040 18028208 0100c000 00480014 01000000 d0000000 28522808 d0000004 00414300 2006090a a4040000 00000700 |