On Target GLRA3_HUMAN 0.26422763/CHEMBL4070615
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.26422763, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | C[C@H]1[C@@H]2[C@H](CN1S(=O)(=O)c3ccc4OCOc4c3)c5cnccc5N(C)C2=O |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |