On Target CASP1_HUMAN 0.28125/CHEMBL602331
For the given ligand Curcumin, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL602331. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL602331 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1ccccc1CNC[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)c2ccc3ccccc3c2)C(C)C |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00028000 00003808 20100108 04010600 00101000 00000100 02000000 22001408 00000000 001108c0 08200000 4000b000 0e008802 00002001 81000401 00082008 00000000 02000001 00c00010 00020201 00000000 38128e08 01000083 0240001c 00001001 c0000000 00000000 90000000 08000300 00060001 a4044000 00802a00 |