On Target PDE4B_HUMAN 0.484375/CHEMBL3315251
For the given ligand Aceclofenac, we have found in our database that, being scored 0.484375, the most similar ligand is CHEMBL3315251. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL3315251 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | OC(=O)Cc1ccc(Nc2nc(nc(n2)c3cccc(Cl)c3)C4CC4)cc1 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00008002 00000800 80000100 40010200 05000040 00000000 04000000 00080840 00000100 000c0840 08208004 40009800 07008004 01108000 c0060040 1808000c 08048800 16006000 08000008 10204001 40000400 08402b00 65006000 00400014 00002000 81000200 00000008 000010a0 0000800c 00660002 c0002880 20020402 |