On Target PDE4B_HUMAN 0.37272727/CHEMBL511115
For the given ligand Alclofenac, we have found in our database that, being scored 0.37272727, the most similar ligand is CHEMBL511115. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL511115 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | COc1ccc(cc1OC2CCCC2)[C@@]3(CC[C@H](CC3)C(=O)O)C#N |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04010000 43000008 2000010a 00210700 00081000 42000000 02040000 00000000 00000800 00080840 08100000 40009000 0480c00a 20a00080 11000001 020ca00c 00c00000 02000000 02482000 00020201 00000100 18000a00 01800400 00400010 00000000 80000000 00120000 00000000 00000202 0106000a 04020000 000004c0 |