On Target ACM4_HUMAN 0.43157893/CHEMBL83
For the given ligand Curcumin, we have found in our database that, being scored 0.43157893, the most similar ligand is CHEMBL83. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL83 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CC\C(=C(/c1ccccc1)\c2ccc(OCCN(C)C)cc2)\c3ccccc3 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 04002000 00000008 20000308 00010602 00001080 00000000 82040080 01000400 00000800 00180840 08300100 40008000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040000 12008001 00400010 01000000 a0000000 00522000 40000000 00400280 00060002 04000000 00000600 |