On Target TNFA_HUMAN 0.32777777/CHEMBL1465706
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.32777777, the most similar ligand is CHEMBL1465706. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL1465706 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | O=C(Nc1ccc(cc1)S(=O)(=O)N2CCCC2)c3ccc(CN4CCc5ccccc5C4)cc3 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 0000401a 00802800 01100100 51b10600 00080030 00000010 00000000 02001008 00000180 004808c0 08282004 6000c000 80008882 00300001 80600440 00000000 00042200 02000020 08400000 00006601 c0120000 18228600 20016000 9940001c 02000000 c0000004 00004000 800000cc 04008500 20060003 a0040000 00010670 |