On Target TNFA_HUMAN 0.352/CHEMBL72511
For the given ligand Alclofenac, we have found in our database that, being scored 0.352, the most similar ligand is CHEMBL72511. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL72511 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CNC(=O)[C@@H](NC(=O)[C@@H]([C@H](CO)C(=O)NO)c1ccc(OC)cc1)C(C)(C)C |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 00060000 00003218 60100108 04010600 00101000 00000000 0a040000 20000008 00200880 000808c0 08300000 4002b000 17008016 00002000 c1000001 00080018 00000000 02000000 00c00008 00060201 00000100 38200600 01000041 83400018 00002800 80000000 00120000 10000000 0c000202 0006000f 20006000 02802e00 |