On Target BACE1_HUMAN 0.3448276/CHEMBL3897096
For the given ligand Aceclofenac, we have found in our database that, being scored 0.3448276, the most similar ligand is CHEMBL3897096. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL3897096 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CC1(COCC(=N1)N)c2cccc(NCc3ccc(Cl)cc3)c2 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 0000c002 00080000 40a00100 80010620 00000040 08010000 10200000 02001040 00c10000 00080853 08200014 6000c800 02000844 00000008 00041040 00080008 08040800 02100000 0c000020 00000000 44110021 28008100 230d0000 00400910 30042408 80100000 40040400 80000088 40448b00 00060002 00040000 80320600 |