On Target NEP_HUMAN 0.2556391/CHEMBL225085
For the given ligand Aceclofenac, we have found in our database that, being scored 0.2556391, the most similar ligand is CHEMBL225085. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL225085 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | COCC[C@H](CC1(CCCC1)C(=O)NCCCc2ccc(Cl)cc2)C(=O)O |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00058000 01001200 00100100 00010700 00280000 00000000 00000000 20000000 00000800 000a08c0 08300000 40019800 0600803e 01800000 00000000 000c0008 00800000 02000100 10402000 00000201 00000100 18040f10 01000000 00500018 00002000 80000000 00040000 10000000 00000200 0106000b 00020000 00022600 |