On Target NOS1_HUMAN 0.28225806/CHEMBL3736597
For the given ligand Alclofenac, we have found in our database that, being scored 0.28225806, the most similar ligand is CHEMBL3736597. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL3736597 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CNCc1cc(OCc2ccc3ccc(N)nc3c2)ccc1Cl |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04008002 44000808 20004108 00010600 00041004 0000c000 02000000 02001000 00400100 00000840 00200004 40008800 82800806 00410080 01000041 020c000c 00000001 02000400 00280000 00220200 40000800 0c008128 20800800 80e49000 00002000 80002200 001000c0 80000000 00000308 00060000 48040000 00020220 |