On Target NK1R_HUMAN 0.36697248/CHEMBL92032
For the given ligand Aceclofenac, we have found in our database that, being scored 0.36697248, the most similar ligand is CHEMBL92032. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL92032 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | N[C@H](COCc1cc(Cl)cc(Cl)c1)c2ccccc2 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00008000 10000000 00000100 80010600 00000050 00004020 04000000 00001040 00000100 00080840 08001000 40008800 02000804 00010400 80041000 02080008 08000000 02000000 04000000 00000000 00010020 08008120 03000000 00400010 00002400 80002000 00080000 00000000 00800200 00060002 40040000 02020400 |