On Target NK1R_HUMAN 0.4224138/CHEMBL369498
For the given ligand Alclofenac, we have found in our database that, being scored 0.4224138, the most similar ligand is CHEMBL369498. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL369498 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CC(C)Oc1cccc(CC(=O)N2CCC(CCN3CCC(CC3)(C(=O)N)c4ccccc4)(C2)c5ccc(Cl)c(Cl)c5)c1 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04028000 47001208 20100108 00010600 00001000 80000010 06000000 20000004 00200880 000808c0 08300000 50039800 07808026 20000080 c1000001 000c0008 00000000 02000000 00080000 00020201 00000100 18240720 00000000 815c0018 00002000 80100000 00040000 10010000 04000200 0006000b 00002000 00822600 |