On Target OPRK_HUMAN 0.41129032/CHEMBL318215
For the given ligand Curcumin, we have found in our database that, being scored 0.41129032, the most similar ligand is CHEMBL318215. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL318215 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1cccc(c1)C2=C(C2C(=O)N(C)[C@H]3CCCC[C@@H]3N4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000000 4b003208 2010130a 04010600 00001000 40000010 820800c0 20000408 00000840 001808c8 08300100 40119000 04008002 20202000 01000003 00060008 00000400 02000040 02082008 00020201 00000500 38040610 00008001 02500018 01000800 80000000 00402000 50000000 08400200 00060d0b 04000000 00002700 |