On Target OPRK_HUMAN 0.41964287/CHEMBL4082214
For the given ligand Alclofenac, we have found in our database that, being scored 0.41964287, the most similar ligand is CHEMBL4082214. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL4082214 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | Cc1cc(C)cc(c1)C2CCCN2Cc3ccc(Oc4ccc(cc4)C(=O)N)c(Cl)c3 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 00008000 09000808 2010010b 00010600 00001001 00000010 16040000 22001000 00100800 000808c8 08300000 40018800 02008806 00200000 81000401 00080008 00002000 02000000 00002000 00020201 00400100 18028700 01000000 00500014 00002000 c0008800 08220000 90200000 00000300 00060002 a0040400 00020600 |