On Target ALDR_HUMAN 0.30994153/CHEMBL261703
For the given ligand Aceclofenac, we have found in our database that, being scored 0.30994153, the most similar ligand is CHEMBL261703. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL261703 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | OC(=O)[C@@H](Cc1cc(O)c(O)cc1[N+](=O)[O-])OC(=O)\C=C\c2cc(O)c(O)cc2[N+](=O)[O-] |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00060002 c2000018 20200500 00010200 00000041 40000000 82002880 00000440 15800800 00080860 4c100004 6010d080 0c018082 0a00a000 20160142 00088018 08020400 82000000 24418018 00028609 40030120 08000a00 25000041 08401014 00001c00 c2000000 00562002 40008660 04400200 00061102 04200010 26000411 |