On Target ALDR_HUMAN 0.50574714/CHEMBL133714
For the given ligand Curcumin, we have found in our database that, being scored 0.50574714, the most similar ligand is CHEMBL133714. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL133714 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | Oc1ccc(\C=C\C(=O)OCc2ccccc2)cc1O |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000000 40000008 20000100 00010200 00000010 00004000 82000080 00000400 01800100 00000840 40000000 40108000 04008002 00010000 00000002 02088008 00020400 02000000 20018018 00020200 00000000 08000a20 00000001 00400000 00001400 80002000 004a2000 40000420 00400200 00020100 44000000 00000010 |