On Target AOFB_HUMAN 0.55/CHEMBL3918471
For the given ligand Curcumin, we have found in our database that, being scored 0.55, the most similar ligand is CHEMBL3918471. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL3918471 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1cccc(\C=C\2/Cc3cc(O)ccc3C2=O)c1 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000000 43000c08 2000030b 00010200 00001000 40808000 82000081 00000400 81800800 00b80840 08100000 40109000 04008002 00201000 01000003 00020008 00000404 02100000 00098008 00020a01 00000100 08020240 0000c000 00400014 01000800 80000000 00522000 40000000 00400200 00020102 84000000 00000500 |