On Target ACM1_HUMAN 0.42975205/CHEMBL72219
For the given ligand Aceclofenac, we have found in our database that, being scored 0.42975205, the most similar ligand is CHEMBL72219. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL72219 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CCN(CC)CCOCCOC(=O)C1(CCCC1)c2ccc(Cl)cc2 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00018000 01000000 0000050a 80010700 000800c0 00000000 00000000 00000040 00002800 00080840 08300000 40009800 0700802e 00a00000 40041008 00099008 18820000 02000000 04402000 00000001 00010120 08000b00 17000000 08400010 00002400 80000000 00040000 00000021 00000202 01060002 00002000 00020600 |