On Target PGH1_SHEEP 0.32142857/CHEMBL298031
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.32142857, the most similar ligand is CHEMBL298031. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL298031 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | COc1ccc(cc1)n2nc(cc2c3ccc(NS(=O)(=O)C)cc3)C(F)(F)F |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00006026 00000a08 a010010a 00310600 01081000 00004002 02440400 00001408 00000104 000108f0 09012004 6000800a 00000c12 02000201 81080041 000e200c 00020000 02801000 04400000 00224008 40100000 1803a820 30800800 83404008 00000080 c0000040 30060000 9000086d 04004304 00460008 40260200 830126e2 |