On Target PGH1_SHEEP 0.5463917/CHEMBL229955
For the given ligand Curcumin, we have found in our database that, being scored 0.5463917, the most similar ligand is CHEMBL229955. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL229955 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1ccc2C=C(CCc2c1)c3ccc(OC)c(OC)c3 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00080000 43000008 2000030a 00110200 20001000 40000000 82040080 00000400 00000800 00180842 08102100 40108000 00024002 20200000 01000023 0002800a 04000400 02000000 00080000 00020201 00100100 18000000 0000c021 00400010 01000000 80000001 00522000 c0000000 00400200 0002010a 04000000 00010500 |