On Target CNR1_HUMAN 0.4180791/CHEMBL247332
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.4180791, the most similar ligand is CHEMBL247332. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL247332 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | O=C(Oc1cccc2cccnc12)c3cccc(c3)S(=O)(=O)N4CCCC4 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 04000012 00800809 6110c108 01b10600 000c1122 04014014 02000000 00200000 02000100 004008c0 00202004 60048000 00808802 08410001 816300c1 020c010c 00022000 02002000 00600000 00026401 c0000000 18028a28 30800000 98c0901c 02000400 80082004 00000200 0000100c 00000600 20060000 c0040000 50010270 |