On Target CNR1_HUMAN 0.4262295/CHEMBL395230
For the given ligand Curcumin, we have found in our database that, being scored 0.4262295, the most similar ligand is CHEMBL395230. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL395230 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CCCCC\C=C\c1cc(O)c2[C@@H]3CC(=CC[C@H]3C(C)(C)Oc2c1)C |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 04000001 c1000018 2000030a 80110300 00081000 82000000 c2000080 00000602 00000900 0018084a 08100000 40108840 00820002 00a00080 11000403 00082008 00800400 22008020 00482000 00022a01 01000100 08000000 01008060 00400410 01200000 c0002000 04406000 c0000000 00410300 00034102 24020000 00010500 |