On Target GRM5_HUMAN 0.2905983/CHEMBL1682796
For the given ligand Curcumin, we have found in our database that, being scored 0.2905983, the most similar ligand is CHEMBL1682796. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL1682796 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | O=C1CCOc2cc(ccc12)C#Cc3ccccc3 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 14000200 40020818 20000908 40090300 00403000 02220000 02000000 00000200 00000900 00080840 08110000 40009860 10808002 00000080 11000001 00082008 00000000 02008400 00480000 00020211 00000100 08820200 01000061 02400014 00000004 c0000000 00100800 00000000 00000300 00020002 80000000 00100400 |