On Target GRM5_HUMAN 0.44444445/CHEMBL1682815
For the given ligand Alclofenac, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL1682815. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL1682815 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | Clc1cccc(COc2ccc3C(=O)CCOc3c2)c1 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04008001 10000818 20000109 00010300 00001000 02224000 46040000 00000200 00000900 00080840 08100000 40009860 12808006 00010000 91000001 02082008 00000000 02008004 00400000 00020801 00000100 08020320 01000060 00c01014 00002000 c0002000 00120800 00000000 00810300 00020002 c0000000 00020400 |