On Target 5HT2A_HUMAN 0.39655173/CHEMBL3736516
For the given ligand Curcumin, we have found in our database that, being scored 0.39655173, the most similar ligand is CHEMBL3736516. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL3736516 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | COc1ccc(CCN(CC\C=C/c2ccccc2)Cc3ccc4OCOc4c3)cc1OC |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000000 4e000008 20100308 00010600 00001000 80000000 820c0080 02001400 00200080 00180848 48200000 40008000 00004802 20000000 01000403 00208008 00000400 02000040 00080000 00020200 00040200 18208000 00008000 81448010 41000000 c0000000 00722000 e0000000 05400300 00060c0a 24040000 00012600 |