On Target MDR1_HUMAN 0.3482143/CHEMBL72
For the given ligand Aceclofenac, we have found in our database that, being scored 0.3482143, the most similar ligand is CHEMBL72. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL72 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CNCCCN1c2ccccc2CCc3ccccc13 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00004002 00000000 00100100 00010600 20000000 00000040 00000010 00000040 00002800 00480960 08300004 40008000 00000000 00000000 00020040 00000002 0004c000 02000000 0800000a 00000001 60100100 18100000 20000000 00400010 00000800 80000000 02000008 00001080 00088000 00260012 00000080 20000700 |