On Target MDR1_HUMAN 0.42682928/CHEMBL1236356
For the given ligand Alclofenac, we have found in our database that, being scored 0.42682928, the most similar ligand is CHEMBL1236356. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL1236356 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CC(C)(C)CC(C)(C)c1ccc(OCCOCCO)cc1 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04000000 01000008 2000010a 00010200 00001000 00000000 02040000 00000040 00002800 00080840 08100000 40008000 00800002 00200000 01200001 000a0008 00000000 02000000 00000002 00020001 00000100 08000000 04000000 08400010 00000400 80000000 00120000 00800020 00000200 00020002 00000000 00000400 |