On Target OPRM_MOUSE 0.4027778/CHEMBL361720
For the given ligand Curcumin, we have found in our database that, being scored 0.4027778, the most similar ligand is CHEMBL361720. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL361720 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CCNC(=O)c1ccc(cc1)C(=C2CC3CCC(C2)N3Cc4cocc4)c5ccc(O)c(OC)c5 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000000 4b200808 20180308 40110600 00001001 00000010 82080080 23201410 00024100 001808c8 0c200000 50118800 c002cc02 20000000 01004403 20008008 00000400 02030040 00082000 00020201 01000000 18028616 00008021 005a001c 01000004 e0004000 00526010 d8801000 00400380 00060d03 a4060000 00002700 |