On Target P2Y12_HUMAN 0.3041237/CHEMBL509572
For the given ligand Aceclofenac, we have found in our database that, being scored 0.3041237, the most similar ligand is CHEMBL509572. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL509572 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | [Na+].[Na+].COc1nc(Cl)nc(Nc2ccc(Nc3cc(c(N)c4C(=O)c5ccccc5C(=O)c34)S(=O)(=O)[O-])cc2S(=O)(=O)[O-])n1 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 0800c402 00801892 00002102 00d10200 80000320 000b8000 10000450 09000a41 80c03900 80080850 08202004 60109140 06008108 00200002 80a203c0 1018000c 00048100 52004001 0810800a 10202000 c5020602 08260340 60004010 0840001e 00044000 a0000600 021c0808 400010a0 22408288 00660082 c700e000 68030c20 |