On Target SCN9A_HUMAN 0.39823008/CHEMBL3657901
For the given ligand Alclofenac, we have found in our database that, being scored 0.39823008, the most similar ligand is CHEMBL3657901. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL3657901 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CC1(C)C(COc2ccc(cc2Cl)C(=O)NS(=O)(=O)C)C1(C)C |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04008000 09000808 20080109 01710700 00081000 02000000 06040001 00001000 00000000 00003840 00102000 40008800 02808806 01000001 91000001 00082008 02800000 02100000 00c00000 00024001 00000000 08028700 01000000 00400014 02002000 80008800 40220000 0000000c 00000200 00060800 80040000 00030360 |