On Target PRGR_HUMAN 0.43537414/CHEMBL3961285
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.43537414, the most similar ligand is CHEMBL3961285. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL3961285 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | Clc1cccc(c1)S(=O)(=O)Nc2ccc(OCc3ccccc3)cc2 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 04008012 00800008 2100010a 00b10200 00001000 00004010 02000000 00000008 00000100 00000840 00002004 60008800 02840406 00010201 81280041 020a0008 00002000 02000000 00400000 00026000 c0000000 08000922 20040040 09c01008 00002080 80102000 00040000 0000000c 00000600 20060000 40000000 00130060 |