On Target PRGR_HUMAN 0.3697479/CHEMBL235063
For the given ligand Alclofenac, we have found in our database that, being scored 0.3697479, the most similar ligand is CHEMBL235063. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL235063 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | COc1ccc(F)cc1C(C)(C)CC(O)(Cc2ccc(cc2Cl)C#N)C(F)(F)F |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 00008000 01000008 2010010a 02010200 00001060 00000010 06000000 00000200 00000900 00882840 08100000 50808ac0 02000006 00201000 81040001 0008220c 88440000 02000000 00c02000 00420001 00000500 08000100 01001440 20500410 00002000 c0000200 80400020 90000001 00100302 0203c402 00000000 00020600 |