On Target DRD4_HUMAN 0.41758242/CHEMBL131484
For the given ligand Alclofenac, we have found in our database that, being scored 0.41758242, the most similar ligand is CHEMBL131484. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL131484 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | Cc1ccc(OCCCNCCOc2ccc(Cl)cc2)cc1 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 0400a000 00000008 20100108 00010602 00001080 02000000 02040000 00000000 00000000 00000840 00200000 40008800 02800006 00000000 01081001 00082008 10200000 02000400 00800000 00020200 00000000 18040100 13000080 00400010 00002001 80000000 00120000 00000001 00000200 00060000 00000000 00020240 |