On Target PGH2_HUMAN 0.8045977/CHEMBL139
For the given ligand Aceclofenac, we have found in our database that, being scored 0.8045977, the most similar ligand is CHEMBL139. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL139 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | OC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 |