On Target ACE_HUMAN 0.25581396/CHEMBL515834
For the given ligand Curcumin, we have found in our database that, being scored 0.25581396, the most similar ligand is CHEMBL515834. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL515834 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | C[C@H](CS)C(=O)N[C@@H](CSCc1ccc(OC(F)(F)F)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000002 40004008 20122528 08110600 00001090 00000000 02040000 00000000 00400000 02024840 00200000 4040b000 02019006 40040100 81080001 00080008 14000008 02000100 00000000 00421300 40000000 18000e00 03000608 04400018 00040200 80000000 00024000 c0000000 02001200 00060021 20204000 03010200 |