On Target 5HT1B_HUMAN 0.3207547/CHEMBL234448
For the given ligand Aceclofenac, we have found in our database that, being scored 0.3207547, the most similar ligand is CHEMBL234448. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL234448 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | C[C@@H]1CN(CCN1CC[C@H]2OCCc3cc(ccc23)C(=O)N)c4cccc5cc(F)ccc45 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00004042 00000a00 00100520 46050600 20000051 00004012 00000000 20001041 00000900 00080ac0 08300004 60008800 80008802 00293000 00060040 0a0c0008 08240000 02000000 0c800402 00000201 40110120 38028628 210040a1 02400016 00000401 80002201 08080000 10000085 08008201 0006880a c0040000 02000600 |