On Target 5HT1B_HUMAN 0.43243244/CHEMBL2260934
For the given ligand Alclofenac, we have found in our database that, being scored 0.43243244, the most similar ligand is CHEMBL2260934. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL2260934 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | CN1CCN(CC1)[C@H](COc2cccc(Cl)c2Cl)c3ccccc3.OC(=O)C(=O)O |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 0400b000 00000008 20000108 04410602 000010c0 02000000 92000000 02001040 04000000 00090840 08200000 4000c800 02808806 00002002 01141403 00082008 18000000 02000000 05800000 00020000 00000000 28048b00 17000020 02400010 00002000 c0108800 00000000 80000001 08000300 00060002 00040000 00020600 |