On Target TLR4_HUMAN 0.24683544/CHEMBL2419465
For the given ligand Aceclofenac, we have found in our database that, being scored 0.24683544, the most similar ligand is CHEMBL2419465. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL2419465 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CCOCCc1oc2c(N)nc3ccccc3c2c1 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00400002 00200000 80084100 00410241 00040642 00400022 00200000 40200240 00004100 400a0840 08000024 4000a800 40080c00 00600080 00040060 400c408c 08004000 42000000 0c200000 00240020 40010021 0c008008 21800800 a4780010 00000410 a0008800 040000d4 08000010 00402208 03060002 00040000 00000400 |