On Target CNR2_HUMAN 0.34848484/CHEMBL3899579
For the given ligand Aceclofenac, we have found in our database that, being scored 0.34848484, the most similar ligand is CHEMBL3899579. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL3899579 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | Fc1cc(Nc2ccc(Cl)cc2Cl)ccc1C(=O)NCC3CC3 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00008082 00001800 00100100 82010600 00000000 00000030 00000010 2a001000 00002000 000048c1 00200004 60008800 02018846 01009400 00000440 00000000 02040200 02000000 08000002 00000201 40000000 18068700 20000000 2040001c 00002000 c0000400 02082000 90000081 00008108 00068001 a0040000 02020200 |