On Target NTRK1_HUMAN 0.38333333/CHEMBL1978371
For the given ligand Curcumin, we have found in our database that, being scored 0.38333333, the most similar ligand is CHEMBL1978371. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL1978371 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | Clc1ccc(cc1)C2CC(=C(C#N)C(=O)C2C(=O)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00018000 01000800 00000302 00110620 00000000 00080000 90000080 00000402 01800900 00188842 08100000 40029800 0602802c 00200000 00000403 00020000 00400400 02000020 0001a008 02000001 00000100 18020380 00008420 00400014 01202802 80002000 00446100 c0000000 00480002 80060002 a4020000 00030480 |