On Target OPRX_HUMAN 0.33076924/CHEMBL186300
For the given ligand Aceclofenac, we have found in our database that, being scored 0.33076924, the most similar ligand is CHEMBL186300. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL186300 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | COC(=O)C(CCN1CCC(O)(CC1)c2ccc(Cl)cc2)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00028000 01000200 00100100 00010700 00100040 00004000 00000000 21000040 00000900 000808c0 08300000 50019800 070080a6 00000000 40040000 000c0008 08020000 02000000 04c00000 00000201 00000100 18000b20 01000080 00500010 00002001 a0000000 00040200 50000000 00000280 0006000a 40002000 00822e00 |