On Target OPRX_HUMAN 0.37301588/CHEMBL512612
For the given ligand Alclofenac, we have found in our database that, being scored 0.37301588, the most similar ligand is CHEMBL512612. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL512612 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | COc1ccc(cc1)C2(CC3CCC(C2)N3C(c4ccccc4Cl)c5ccccc5Cl)C(=O)N |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 00038000 01000208 2010010a 00010600 00001000 00000010 02040000 23001000 00200800 800808c0 08300000 50039800 0700880e 00200000 41000401 00040008 00000000 02000000 00002000 00020201 00000d00 18008710 00000000 81500010 00002000 e0000200 00120000 d0001180 04000382 0006000a 2c062000 00822600 |