On Target FYN_HUMAN 0.3586207/CHEMBL1097700
For the given ligand Curcumin, we have found in our database that, being scored 0.3586207, the most similar ligand is CHEMBL1097700. Check out the elaboration below.
| Curcumin (Given Ligand) | CHEMBL1097700 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CNc1cc(O)c2C(=O)O[C@@H](C)[C@H](C)\C=C/C(=O)[C@@H](O)[C@@H](O)C\C=C\c2c1 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00090002 c1000808 20000b00 80090200 02000014 0002c000 82100280 00000c02 01000100 00108850 00240204 4010d800 14028002 00318000 00000446 02082008 00060c00 02000000 08452000 0002a603 40100020 68021aa0 2520a020 00400014 01240400 80002000 00487001 c0000080 00408201 00060100 e4000000 02000000 |