On Target CAH2_HUMAN 0.3838384/CHEMBL23832
For the given ligand Aceclofenac, we have found in our database that, being scored 0.3838384, the most similar ligand is CHEMBL23832. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL23832 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | OC(=O)c1ccccc1Nc2ccccc2 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00000002 00000800 00000100 00010200 00000000 00014000 00000010 00000040 00802100 00000840 00200004 40009000 04008000 00000000 00020040 00080008 00040000 02000000 0800800a 00000000 40000000 08020a20 20000000 00400004 00000000 80000000 02000000 00001080 00008000 00260000 c0000000 00000000 |