On Target CAH2_HUMAN 0.4375/CHEMBL2407314
For the given ligand Alclofenac, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL2407314. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL2407314 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | Clc1ccc(CC(=O)Oc2ccc3CCS(=O)(=O)Oc3c2)cc1 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04009001 04020008 20000308 00510280 20003160 0a008000 c2040000 00000240 00010000 01890840 08002000 42009840 03888826 10040002 c10d0001 00082008 08020000 0200a00c 04a00000 00020800 00000040 08000b00 11000000 02540011 00082002 80100000 10160400 00000200 00010200 00024402 00002002 11030420 |